C15H22O3 — CID 11831848
6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 11831848) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol.
| Compound Name | 6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 11831848 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | CCCCOc1ccc2c(c1)C(O)CC(C)(C)O2 |
| InChI | InChI=1S/C15H22O3/c1-4-5-8-17-11-6-7-14-12(9-11)13(16)10-15(2,3)18-14/h6-7,9,13,16H,4-5,8,10H2,1-3H3 |
| InChIKey | CGEFNJDIMJVUNH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|