C23H39NO4S — CID 59941104
N-(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-butylbutane-1-sulfonamide (PubChem CID 59941104) has the molecular formula C23H39NO4S and a molecular weight of 425.64 g/mol. Its IUPAC name is N-(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-butylbutane-1-sulfonamide.
| Compound Name | N-(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-butylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 59941104 |
| Molecular Formula | C23H39NO4S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | N-(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-butylbutane-1-sulfonamide |
| SMILES | CCCCOc1ccc2c(c1)C(N(CCCC)S(=O)(=O)CCCC)CC(C)(C)O2 |
| InChI | InChI=1S/C23H39NO4S/c1-6-9-14-24(29(25,26)16-11-8-3)21-18-23(4,5)28-22-13-12-19(17-20(21)22)27-15-10-7-2/h12-13,17,21H,6-11,14-16,18H2,1-5H3 |
| InChIKey | WQSUSVKFGAEFKS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|