C20H31NO6S — CID 59941134
4-[(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-methylsulfonylamino]butanoic acid (PubChem CID 59941134) has the molecular formula C20H31NO6S and a molecular weight of 413.54 g/mol. Its IUPAC name is 4-[(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-methylsulfonylamino]butanoic acid.
| Compound Name | 4-[(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-methylsulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 59941134 |
| Molecular Formula | C20H31NO6S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 4-[(6-butoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-methylsulfonylamino]butanoic acid |
| SMILES | CCCCOc1ccc2c(c1)C(N(CCCC(=O)O)S(C)(=O)=O)CC(C)(C)O2 |
| InChI | InChI=1S/C20H31NO6S/c1-5-6-12-26-15-9-10-18-16(13-15)17(14-20(2,3)27-18)21(28(4,24)25)11-7-8-19(22)23/h9-10,13,17H,5-8,11-12,14H2,1-4H3,(H,22,23) |
| InChIKey | SKYVDWXZURKFBU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|