C19H30FNO3S — CID 59941111
N-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-hexylethanesulfonamide (PubChem CID 59941111) has the molecular formula C19H30FNO3S and a molecular weight of 371.52 g/mol. Its IUPAC name is N-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-hexylethanesulfonamide.
| Compound Name | N-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-hexylethanesulfonamide |
|---|---|
| PubChem CID | 59941111 |
| Molecular Formula | C19H30FNO3S |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-N-hexylethanesulfonamide |
| SMILES | CCCCCCN(C1CC(C)(C)Oc2ccc(F)cc21)S(=O)(=O)CC |
| InChI | InChI=1S/C19H30FNO3S/c1-5-7-8-9-12-21(25(22,23)6-2)17-14-19(3,4)24-18-11-10-15(20)13-16(17)18/h10-11,13,17H,5-9,12,14H2,1-4H3 |
| InChIKey | ZFWWYFNVKJPHEH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|