C25H38N4O4S — CID 15859753
5-[ethylsulfonyl-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)amino]-N-(3-imidazol-1-ylpropyl)pentanamide (PubChem CID 15859753) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is 5-[ethylsulfonyl-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)amino]-N-(3-imidazol-1-ylpropyl)pentanamide.
| Compound Name | 5-[ethylsulfonyl-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)amino]-N-(3-imidazol-1-ylpropyl)pentanamide |
|---|---|
| PubChem CID | 15859753 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 5-[ethylsulfonyl-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)amino]-N-(3-imidazol-1-ylpropyl)pentanamide |
| SMILES | CCS(=O)(=O)N(CCCCC(=O)NCCCn1ccnc1)C1CC(C)(C)Oc2ccc(C)cc21 |
| InChI | InChI=1S/C25H38N4O4S/c1-5-34(31,32)29(22-18-25(3,4)33-23-11-10-20(2)17-21(22)23)15-7-6-9-24(30)27-12-8-14-28-16-13-26-19-28/h10-11,13,16-17,19,22H,5-9,12,14-15,18H2,1-4H3,(H,27,30) |
| InChIKey | MDQBBBHQHLVRCT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|