C17H22F2N4O3S — CID 100578695
4-(3,4-difluoro-N-methylsulfonylanilino)-N-(3-imidazol-1-ylpropyl)butanamide (PubChem CID 100578695) has the molecular formula C17H22F2N4O3S and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(3-imidazol-1-ylpropyl)butanamide.
| Compound Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(3-imidazol-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 100578695 |
| Molecular Formula | C17H22F2N4O3S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 4-(3,4-difluoro-N-methylsulfonylanilino)-N-(3-imidazol-1-ylpropyl)butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)NCCCn1ccnc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H22F2N4O3S/c1-27(25,26)23(14-5-6-15(18)16(19)12-14)10-2-4-17(24)21-7-3-9-22-11-8-20-13-22/h5-6,8,11-13H,2-4,7,9-10H2,1H3,(H,21,24) |
| InChIKey | XLZZWAQQPKVQSS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|