C14H20F2N2O3S — CID 113072464
N-[2-(3,4-difluoro-N-methylsulfonylanilino)ethyl]-3-methylbutanamide (PubChem CID 113072464) has the molecular formula C14H20F2N2O3S and a molecular weight of 334.39 g/mol. Its IUPAC name is N-[2-(3,4-difluoro-N-methylsulfonylanilino)ethyl]-3-methylbutanamide.
| Compound Name | N-[2-(3,4-difluoro-N-methylsulfonylanilino)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 113072464 |
| Molecular Formula | C14H20F2N2O3S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[2-(3,4-difluoro-N-methylsulfonylanilino)ethyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NCCN(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C14H20F2N2O3S/c1-10(2)8-14(19)17-6-7-18(22(3,20)21)11-4-5-12(15)13(16)9-11/h4-5,9-10H,6-8H2,1-3H3,(H,17,19) |
| InChIKey | GALRKWRHBSHUEM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |