C15H20F2N2O2 — CID 113064598
N-[2-(N-acetyl-3,4-difluoroanilino)ethyl]-3-methylbutanamide (PubChem CID 113064598) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is N-[2-(N-acetyl-3,4-difluoroanilino)ethyl]-3-methylbutanamide.
| Compound Name | N-[2-(N-acetyl-3,4-difluoroanilino)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 113064598 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-[2-(N-acetyl-3,4-difluoroanilino)ethyl]-3-methylbutanamide |
| SMILES | CC(=O)N(CCNC(=O)CC(C)C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-10(2)8-15(21)18-6-7-19(11(3)20)12-4-5-13(16)14(17)9-12/h4-5,9-10H,6-8H2,1-3H3,(H,18,21) |
| InChIKey | FFKYDMQCRDIABY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |