C12H17F2N3O3S — CID 113064664
N-(3,4-difluorophenyl)-N-[2-(dimethylsulfamoylamino)ethyl]acetamide (PubChem CID 113064664) has the molecular formula C12H17F2N3O3S and a molecular weight of 321.35 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N-[2-(dimethylsulfamoylamino)ethyl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-N-[2-(dimethylsulfamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 113064664 |
| Molecular Formula | C12H17F2N3O3S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-N-[2-(dimethylsulfamoylamino)ethyl]acetamide |
| SMILES | CC(=O)N(CCNS(=O)(=O)N(C)C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H17F2N3O3S/c1-9(18)17(7-6-15-21(19,20)16(2)3)10-4-5-11(13)12(14)8-10/h4-5,8,15H,6-7H2,1-3H3 |
| InChIKey | OMHYFIWOFUSBAW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |