C12H18ClN3O3S — CID 113059573
N-(3-chlorophenyl)-N-[2-(dimethylsulfamoylamino)ethyl]acetamide (PubChem CID 113059573) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[2-(dimethylsulfamoylamino)ethyl]acetamide.
| Compound Name | N-(3-chlorophenyl)-N-[2-(dimethylsulfamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 113059573 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-(3-chlorophenyl)-N-[2-(dimethylsulfamoylamino)ethyl]acetamide |
| SMILES | CC(=O)N(CCNS(=O)(=O)N(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H18ClN3O3S/c1-10(17)16(12-6-4-5-11(13)9-12)8-7-14-20(18,19)15(2)3/h4-6,9,14H,7-8H2,1-3H3 |
| InChIKey | CCBRAVKSHANMPK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |