C11H15FN2O3S — CID 113059351
N-(4-fluorophenyl)-N-[2-(methanesulfonamido)ethyl]acetamide (PubChem CID 113059351) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[2-(methanesulfonamido)ethyl]acetamide.
| Compound Name | N-(4-fluorophenyl)-N-[2-(methanesulfonamido)ethyl]acetamide |
|---|---|
| PubChem CID | 113059351 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-(4-fluorophenyl)-N-[2-(methanesulfonamido)ethyl]acetamide |
| SMILES | CC(=O)N(CCNS(C)(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2O3S/c1-9(15)14(8-7-13-18(2,16)17)11-5-3-10(12)4-6-11/h3-6,13H,7-8H2,1-2H3 |
| InChIKey | DCTWKKSTSFGDMO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |