C15H21FN2O2 — CID 113059285
N-[2-(N-acetyl-4-fluoroanilino)ethyl]-2,2-dimethylpropanamide (PubChem CID 113059285) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is N-[2-(N-acetyl-4-fluoroanilino)ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(N-acetyl-4-fluoroanilino)ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 113059285 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[2-(N-acetyl-4-fluoroanilino)ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(=O)N(CCNC(=O)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2O2/c1-11(19)18(13-7-5-12(16)6-8-13)10-9-17-14(20)15(2,3)4/h5-8H,9-10H2,1-4H3,(H,17,20) |
| InChIKey | ULVGVNFJSRRQHI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |