C17H24N2O3 — CID 113061547
N-[2-(N,3-diacetylanilino)ethyl]-2,2-dimethylpropanamide (PubChem CID 113061547) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[2-(N,3-diacetylanilino)ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(N,3-diacetylanilino)ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 113061547 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[2-(N,3-diacetylanilino)ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(=O)c1cccc(N(CCNC(=O)C(C)(C)C)C(C)=O)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(20)14-7-6-8-15(11-14)19(13(2)21)10-9-18-16(22)17(3,4)5/h6-8,11H,9-10H2,1-5H3,(H,18,22) |
| InChIKey | UIZBQNPRFNYXLM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |