C21H24N2O3 — CID 113061592
N-[2-(N,3-diacetylanilino)ethyl]-2-(3-methylphenyl)acetamide (PubChem CID 113061592) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[2-(N,3-diacetylanilino)ethyl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[2-(N,3-diacetylanilino)ethyl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113061592 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[2-(N,3-diacetylanilino)ethyl]-2-(3-methylphenyl)acetamide |
| SMILES | CC(=O)c1cccc(N(CCNC(=O)Cc2cccc(C)c2)C(C)=O)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-15-6-4-7-18(12-15)13-21(26)22-10-11-23(17(3)25)20-9-5-8-19(14-20)16(2)24/h4-9,12,14H,10-11,13H2,1-3H3,(H,22,26) |
| InChIKey | ZZUCEYKRPIEBNK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |