C16H18N2O4S2 — CID 113061619
N-(3-acetylphenyl)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide (PubChem CID 113061619) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide.
| Compound Name | N-(3-acetylphenyl)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 113061619 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | N-(3-acetylphenyl)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide |
| SMILES | CC(=O)c1cccc(N(CCNS(=O)(=O)c2cccs2)C(C)=O)c1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-12(19)14-5-3-6-15(11-14)18(13(2)20)9-8-17-24(21,22)16-7-4-10-23-16/h3-7,10-11,17H,8-9H2,1-2H3 |
| InChIKey | HMSJYMXVNXUOME-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |