C15H15N3O3S2 — CID 113064398
N-(4-cyanophenyl)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide (PubChem CID 113064398) has the molecular formula C15H15N3O3S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is N-(4-cyanophenyl)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide.
| Compound Name | N-(4-cyanophenyl)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 113064398 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-(4-cyanophenyl)-N-[2-(thiophen-2-ylsulfonylamino)ethyl]acetamide |
| SMILES | CC(=O)N(CCNS(=O)(=O)c1cccs1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H15N3O3S2/c1-12(19)18(14-6-4-13(11-16)5-7-14)9-8-17-23(20,21)15-3-2-10-22-15/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | IJJPIDDYXBXOGN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |