C17H23N3O3S2 — CID 113062233
N-[4-(dimethylamino)phenyl]-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]acetamide (PubChem CID 113062233) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 113062233 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-N-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)N(CCNS(=O)(=O)c1ccc(C)s1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H23N3O3S2/c1-13-5-10-17(24-13)25(22,23)18-11-12-20(14(2)21)16-8-6-15(7-9-16)19(3)4/h5-10,18H,11-12H2,1-4H3 |
| InChIKey | CKKZCYLVJOMEKH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|