C19H19FN2O4 — CID 113061960
methyl 3-[acetyl-[2-[(4-fluorobenzoyl)amino]ethyl]amino]benzoate (PubChem CID 113061960) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is methyl 3-[acetyl-[2-[(4-fluorobenzoyl)amino]ethyl]amino]benzoate.
| Compound Name | methyl 3-[acetyl-[2-[(4-fluorobenzoyl)amino]ethyl]amino]benzoate |
|---|---|
| PubChem CID | 113061960 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | methyl 3-[acetyl-[2-[(4-fluorobenzoyl)amino]ethyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(N(CCNC(=O)c2ccc(F)cc2)C(C)=O)c1 |
| InChI | InChI=1S/C19H19FN2O4/c1-13(23)22(17-5-3-4-15(12-17)19(25)26-2)11-10-21-18(24)14-6-8-16(20)9-7-14/h3-9,12H,10-11H2,1-2H3,(H,21,24) |
| InChIKey | ODIDJIOZOLJAAC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |