C15H20Cl2N2O2 — CID 113063717
N-[2-(N-acetyl-3,5-dichloroanilino)ethyl]-2,2-dimethylpropanamide (PubChem CID 113063717) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is N-[2-(N-acetyl-3,5-dichloroanilino)ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(N-acetyl-3,5-dichloroanilino)ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 113063717 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-[2-(N-acetyl-3,5-dichloroanilino)ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(=O)N(CCNC(=O)C(C)(C)C)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-10(20)19(6-5-18-14(21)15(2,3)4)13-8-11(16)7-12(17)9-13/h7-9H,5-6H2,1-4H3,(H,18,21) |
| InChIKey | JOMPPVDJLJJGEW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |