C15H20Cl2N2O3 — CID 141067660
tert-butyl N-(2-acetamidoethyl)-N-(3,5-dichlorophenyl)carbamate (PubChem CID 141067660) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is tert-butyl N-(2-acetamidoethyl)-N-(3,5-dichlorophenyl)carbamate.
| Compound Name | tert-butyl N-(2-acetamidoethyl)-N-(3,5-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 141067660 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | tert-butyl N-(2-acetamidoethyl)-N-(3,5-dichlorophenyl)carbamate |
| SMILES | CC(=O)NCCN(C(=O)OC(C)(C)C)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-10(20)18-5-6-19(14(21)22-15(2,3)4)13-8-11(16)7-12(17)9-13/h7-9H,5-6H2,1-4H3,(H,18,20) |
| InChIKey | PNYLEHFYBBPGFM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |