C17H21F5N2O4 — CID 54397769
tert-butyl N-[2-(2,2,3,3,3-pentafluoropropoxycarbonylamino)ethyl]-N-phenylcarbamate (PubChem CID 54397769) has the molecular formula C17H21F5N2O4 and a molecular weight of 412.36 g/mol. Its IUPAC name is tert-butyl N-[2-(2,2,3,3,3-pentafluoropropoxycarbonylamino)ethyl]-N-phenylcarbamate.
| Compound Name | tert-butyl N-[2-(2,2,3,3,3-pentafluoropropoxycarbonylamino)ethyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 54397769 |
| Molecular Formula | C17H21F5N2O4 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | tert-butyl N-[2-(2,2,3,3,3-pentafluoropropoxycarbonylamino)ethyl]-N-phenylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNC(=O)OCC(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H21F5N2O4/c1-15(2,3)28-14(26)24(12-7-5-4-6-8-12)10-9-23-13(25)27-11-16(18,19)17(20,21)22/h4-8H,9-11H2,1-3H3,(H,23,25) |
| InChIKey | VLFWVYSUCQWWCU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|