C17H29NO5Si — CID 19019620
tert-butyl N-phenyl-N-(3-trimethoxysilylpropyl)carbamate (PubChem CID 19019620) has the molecular formula C17H29NO5Si and a molecular weight of 355.51 g/mol. Its IUPAC name is tert-butyl N-phenyl-N-(3-trimethoxysilylpropyl)carbamate.
| Compound Name | tert-butyl N-phenyl-N-(3-trimethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 19019620 |
| Molecular Formula | C17H29NO5Si |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | tert-butyl N-phenyl-N-(3-trimethoxysilylpropyl)carbamate |
| SMILES | CO[Si](CCCN(C(=O)OC(C)(C)C)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C17H29NO5Si/c1-17(2,3)23-16(19)18(15-11-8-7-9-12-15)13-10-14-24(20-4,21-5)22-6/h7-9,11-12H,10,13-14H2,1-6H3 |
| InChIKey | ILCQVTWZRNPYFJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|