C15H22F3NO4Si — CID 59966866
3,3,3-trifluoro-N-phenyl-N-(3-trimethoxysilylpropyl)propanamide (PubChem CID 59966866) has the molecular formula C15H22F3NO4Si and a molecular weight of 365.42 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-phenyl-N-(3-trimethoxysilylpropyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-phenyl-N-(3-trimethoxysilylpropyl)propanamide |
|---|---|
| PubChem CID | 59966866 |
| Molecular Formula | C15H22F3NO4Si |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3,3,3-trifluoro-N-phenyl-N-(3-trimethoxysilylpropyl)propanamide |
| SMILES | CO[Si](CCCN(C(=O)CC(F)(F)F)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C15H22F3NO4Si/c1-21-24(22-2,23-3)11-7-10-19(13-8-5-4-6-9-13)14(20)12-15(16,17)18/h4-6,8-9H,7,10-12H2,1-3H3 |
| InChIKey | ZSTXUBKUOUODOI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|