C19H20F11NO2Si — CID 165154360
N-[3-[ethenyl(dimethyl)silyl]propyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-phenylpropanamide (PubChem CID 165154360) has the molecular formula C19H20F11NO2Si and a molecular weight of 531.44 g/mol. Its IUPAC name is N-[3-[ethenyl(dimethyl)silyl]propyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-phenylpropanamide.
| Compound Name | N-[3-[ethenyl(dimethyl)silyl]propyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-phenylpropanamide |
|---|---|
| PubChem CID | 165154360 |
| Molecular Formula | C19H20F11NO2Si |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | N-[3-[ethenyl(dimethyl)silyl]propyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-phenylpropanamide |
| SMILES | C=C[Si](C)(C)CCCN(C(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H20F11NO2Si/c1-4-34(2,3)12-8-11-31(13-9-6-5-7-10-13)14(32)15(20,17(23,24)25)33-19(29,30)16(21,22)18(26,27)28/h4-7,9-10H,1,8,11-12H2,2-3H3 |
| InChIKey | LJWUKELEOZKTBX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|