C21H29NSi — CID 68781079
N,N-dibenzyl-3-[ethenyl(dimethyl)silyl]propan-1-amine (PubChem CID 68781079) has the molecular formula C21H29NSi and a molecular weight of 323.56 g/mol. Its IUPAC name is N,N-dibenzyl-3-[ethenyl(dimethyl)silyl]propan-1-amine.
| Compound Name | N,N-dibenzyl-3-[ethenyl(dimethyl)silyl]propan-1-amine |
|---|---|
| PubChem CID | 68781079 |
| Molecular Formula | C21H29NSi |
| Molecular Weight | 323.56 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N,N-dibenzyl-3-[ethenyl(dimethyl)silyl]propan-1-amine |
| SMILES | C=C[Si](C)(C)CCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H29NSi/c1-4-23(2,3)17-11-16-22(18-20-12-7-5-8-13-20)19-21-14-9-6-10-15-21/h4-10,12-15H,1,11,16-19H2,2-3H3 |
| InChIKey | HBOHPRVASOXZGB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|