C19H35NSi2 — CID 68779162
N-[3-[ethenyl(dimethyl)silyl]propyl]-N-triethylsilylaniline (PubChem CID 68779162) has the molecular formula C19H35NSi2 and a molecular weight of 333.67 g/mol. Its IUPAC name is N-[3-[ethenyl(dimethyl)silyl]propyl]-N-triethylsilylaniline.
| Compound Name | N-[3-[ethenyl(dimethyl)silyl]propyl]-N-triethylsilylaniline |
|---|---|
| PubChem CID | 68779162 |
| Molecular Formula | C19H35NSi2 |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N-[3-[ethenyl(dimethyl)silyl]propyl]-N-triethylsilylaniline |
| SMILES | C=C[Si](C)(C)CCCN(c1ccccc1)[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H35NSi2/c1-7-21(5,6)18-14-17-20(19-15-12-11-13-16-19)22(8-2,9-3)10-4/h7,11-13,15-16H,1,8-10,14,17-18H2,2-6H3 |
| InChIKey | DUPIGYYSACKYCP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|