C21H39NSi2 — CID 56935519
(E)-3-phenyl-N,N-bis(triethylsilyl)prop-1-en-1-amine (PubChem CID 56935519) has the molecular formula C21H39NSi2 and a molecular weight of 361.72 g/mol. Its IUPAC name is (E)-3-phenyl-N,N-bis(triethylsilyl)prop-1-en-1-amine.
| Compound Name | (E)-3-phenyl-N,N-bis(triethylsilyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 56935519 |
| Molecular Formula | C21H39NSi2 |
| Molecular Weight | 361.72 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | (E)-3-phenyl-N,N-bis(triethylsilyl)prop-1-en-1-amine |
| SMILES | CC[Si](CC)(CC)N(/C=C/Cc1ccccc1)[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H39NSi2/c1-7-23(8-2,9-3)22(24(10-4,11-5)12-6)20-16-19-21-17-14-13-15-18-21/h13-18,20H,7-12,19H2,1-6H3/b20-16+ |
| InChIKey | YKEBKOAVXZTTKS-CAPFRKAQSA-N |
| XLogP | 7.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.72 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|