C41H75N3O5Si5 — CID 158236338
N-[3-[[diethoxy-[3-(N-trimethylsilylanilino)propyl]silyl]oxy-diethoxysilyl]propyl]-N-trimethylsilylaniline;N-trimethylsilylaniline (PubChem CID 158236338) has the molecular formula C41H75N3O5Si5 and a molecular weight of 830.50 g/mol. Its IUPAC name is N-[3-[[diethoxy-[3-(N-trimethylsilylanilino)propyl]silyl]oxy-diethoxysilyl]propyl]-N-trimethylsilylaniline;N-trimethylsilylaniline.
| Compound Name | N-[3-[[diethoxy-[3-(N-trimethylsilylanilino)propyl]silyl]oxy-diethoxysilyl]propyl]-N-trimethylsilylaniline;N-trimethylsilylaniline |
|---|---|
| PubChem CID | 158236338 |
| Molecular Formula | C41H75N3O5Si5 |
| Molecular Weight | 830.50 g/mol |
| Exact Mass | 829.46 |
| IUPAC Name | N-[3-[[diethoxy-[3-(N-trimethylsilylanilino)propyl]silyl]oxy-diethoxysilyl]propyl]-N-trimethylsilylaniline;N-trimethylsilylaniline |
| SMILES | CCO[Si](CCCN(c1ccccc1)[Si](C)(C)C)(OCC)O[Si](CCCN(c1ccccc1)[Si](C)(C)C)(OCC)OCC.C[Si](C)(C)Nc1ccccc1 |
| InChI | InChI=1S/C32H60N2O5Si4.C9H15NSi/c1-11-35-42(36-12-2,29-21-27-33(40(5,6)7)31-23-17-15-18-24-31)39-43(37-13-3,38-14-4)30-22-28-34(41(8,9)10)32-25-19-16-20-26-32;1-11(2,3)10-9-7-5-4-6-8-9/h15-20,23-26H,11-14,21-22,27-30H2,1-10H3;4-8,10H,1-3H3 |
| InChIKey | GEZUPFCZKLWZLV-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 64.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.50 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|