C25H37BrN2O4Si — CID 18920589
2-methyl-N-[4-[N-(3-triethoxysilylpropyl)anilino]phenyl]prop-2-enamide;hydrobromide (PubChem CID 18920589) has the molecular formula C25H37BrN2O4Si and a molecular weight of 537.57 g/mol. Its IUPAC name is 2-methyl-N-[4-[N-(3-triethoxysilylpropyl)anilino]phenyl]prop-2-enamide;hydrobromide.
| Compound Name | 2-methyl-N-[4-[N-(3-triethoxysilylpropyl)anilino]phenyl]prop-2-enamide;hydrobromide |
|---|---|
| PubChem CID | 18920589 |
| Molecular Formula | C25H37BrN2O4Si |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 2-methyl-N-[4-[N-(3-triethoxysilylpropyl)anilino]phenyl]prop-2-enamide;hydrobromide |
| SMILES | Br.C=C(C)C(=O)Nc1ccc(N(CCC[Si](OCC)(OCC)OCC)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H36N2O4Si.BrH/c1-6-29-32(30-7-2,31-8-3)20-12-19-27(23-13-10-9-11-14-23)24-17-15-22(16-18-24)26-25(28)21(4)5;/h9-11,13-18H,4,6-8,12,19-20H2,1-3,5H3,(H,26,28);1H |
| InChIKey | MYLXDPOIXPWAHX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|