C25H37IN2O4Si — CID 70148443
2-methyl-N-[4-[2-(3-triethoxysilylpropylamino)phenyl]phenyl]prop-2-enamide;hydroiodide (PubChem CID 70148443) has the molecular formula C25H37IN2O4Si and a molecular weight of 584.57 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-(3-triethoxysilylpropylamino)phenyl]phenyl]prop-2-enamide;hydroiodide.
| Compound Name | 2-methyl-N-[4-[2-(3-triethoxysilylpropylamino)phenyl]phenyl]prop-2-enamide;hydroiodide |
|---|---|
| PubChem CID | 70148443 |
| Molecular Formula | C25H37IN2O4Si |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 2-methyl-N-[4-[2-(3-triethoxysilylpropylamino)phenyl]phenyl]prop-2-enamide;hydroiodide |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2ccccc2NCCC[Si](OCC)(OCC)OCC)cc1.I |
| InChI | InChI=1S/C25H36N2O4Si.HI/c1-6-29-32(30-7-2,31-8-3)19-11-18-26-24-13-10-9-12-23(24)21-14-16-22(17-15-21)27-25(28)20(4)5;/h9-10,12-17,26H,4,6-8,11,18-19H2,1-3,5H3,(H,27,28);1H |
| InChIKey | JZORCBTXFVBRKK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|