C26H38N4O5Si — CID 102049363
N'-(4-phenyldiazenylphenyl)-N-(3-triethoxysilylpropyl)pentanediamide (PubChem CID 102049363) has the molecular formula C26H38N4O5Si and a molecular weight of 514.70 g/mol. Its IUPAC name is N'-(4-phenyldiazenylphenyl)-N-(3-triethoxysilylpropyl)pentanediamide.
| Compound Name | N'-(4-phenyldiazenylphenyl)-N-(3-triethoxysilylpropyl)pentanediamide |
|---|---|
| PubChem CID | 102049363 |
| Molecular Formula | C26H38N4O5Si |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N'-(4-phenyldiazenylphenyl)-N-(3-triethoxysilylpropyl)pentanediamide |
| SMILES | CCO[Si](CCCNC(=O)CCCC(=O)Nc1ccc(/N=N/c2ccccc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C26H38N4O5Si/c1-4-33-36(34-5-2,35-6-3)21-11-20-27-25(31)14-10-15-26(32)28-22-16-18-24(19-17-22)30-29-23-12-8-7-9-13-23/h7-9,12-13,16-19H,4-6,10-11,14-15,20-21H2,1-3H3,(H,27,31)(H,28,32)/b30-29+ |
| InChIKey | OUSCMLCTBHEGMQ-QVIHXGFCSA-N |
| XLogP | 5.77 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|