C22H21N5O2 — CID 55342078
3-(phenylcarbamoylamino)-N-(4-phenyldiazenylphenyl)propanamide (PubChem CID 55342078) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-(phenylcarbamoylamino)-N-(4-phenyldiazenylphenyl)propanamide.
| Compound Name | 3-(phenylcarbamoylamino)-N-(4-phenyldiazenylphenyl)propanamide |
|---|---|
| PubChem CID | 55342078 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-(phenylcarbamoylamino)-N-(4-phenyldiazenylphenyl)propanamide |
| SMILES | O=C(CCNC(=O)Nc1ccccc1)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N5O2/c28-21(15-16-23-22(29)25-17-7-3-1-4-8-17)24-18-11-13-20(14-12-18)27-26-19-9-5-2-6-10-19/h1-14H,15-16H2,(H,24,28)(H2,23,25,29)/b27-26+ |
| InChIKey | HFKZIKBLBIPNNA-CYYJNZCTSA-N |
| XLogP | 5.25 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|