C16H29N3O6SSi — CID 102277551
1-(4-sulfamoylphenyl)-3-(3-triethoxysilylpropyl)urea (PubChem CID 102277551) has the molecular formula C16H29N3O6SSi and a molecular weight of 419.58 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)-3-(3-triethoxysilylpropyl)urea.
| Compound Name | 1-(4-sulfamoylphenyl)-3-(3-triethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 102277551 |
| Molecular Formula | C16H29N3O6SSi |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-(4-sulfamoylphenyl)-3-(3-triethoxysilylpropyl)urea |
| SMILES | CCO[Si](CCCNC(=O)Nc1ccc(S(N)(=O)=O)cc1)(OCC)OCC |
| InChI | InChI=1S/C16H29N3O6SSi/c1-4-23-27(24-5-2,25-6-3)13-7-12-18-16(20)19-14-8-10-15(11-9-14)26(17,21)22/h8-11H,4-7,12-13H2,1-3H3,(H2,17,21,22)(H2,18,19,20) |
| InChIKey | FRTGYNFSDOZDSU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|