C21H27Cl6N5O4Si — CID 59002407
1-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-(3-triethoxysilylpropyl)urea (PubChem CID 59002407) has the molecular formula C21H27Cl6N5O4Si and a molecular weight of 654.28 g/mol. Its IUPAC name is 1-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-(3-triethoxysilylpropyl)urea.
| Compound Name | 1-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-(3-triethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 59002407 |
| Molecular Formula | C21H27Cl6N5O4Si |
| Molecular Weight | 654.28 g/mol |
| Exact Mass | 651.00 |
| IUPAC Name | 1-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-(3-triethoxysilylpropyl)urea |
| SMILES | CCO[Si](CCCNC(=O)Nc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1)(OCC)OCC |
| InChI | InChI=1S/C21H27Cl6N5O4Si/c1-4-34-37(35-5-2,36-6-3)13-7-12-28-19(33)29-15-10-8-14(9-11-15)16-30-17(20(22,23)24)32-18(31-16)21(25,26)27/h8-11H,4-7,12-13H2,1-3H3,(H2,28,29,33) |
| InChIKey | RAASOJSOSDVNJE-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.28 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|