C24H23Cl6CoN5O2-2 — CID 89331044
N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]benzamide;hexylazanide;oxocobalt (PubChem CID 89331044) has the molecular formula C24H23Cl6CoN5O2-2 and a molecular weight of 685.13 g/mol. Its IUPAC name is N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]benzamide;hexylazanide;oxocobalt.
| Compound Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]benzamide;hexylazanide;oxocobalt |
|---|---|
| PubChem CID | 89331044 |
| Molecular Formula | C24H23Cl6CoN5O2-2 |
| Molecular Weight | 685.13 g/mol |
| Exact Mass | 681.93 |
| IUPAC Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]benzamide;hexylazanide;oxocobalt |
| SMILES | CCCCCC[NH-].O=C(Nc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1)c1cc[c-]cc1.O=[Co] |
| InChI | InChI=1S/C18H9Cl6N4O.C6H14N.Co.O/c19-17(20,21)15-26-13(27-16(28-15)18(22,23)24)10-6-8-12(9-7-10)25-14(29)11-4-2-1-3-5-11;1-2-3-4-5-6-7;;/h2-9H,(H,25,29);7H,2-6H2,1H3;;/q2*-1;; |
| InChIKey | YQMRWAKNGOSXQO-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.13 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|