C26H26ClN3O — CID 42658273
N-[4-(6-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]-4-hexylbenzamide (PubChem CID 42658273) has the molecular formula C26H26ClN3O and a molecular weight of 431.97 g/mol. Its IUPAC name is N-[4-(6-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]-4-hexylbenzamide.
| Compound Name | N-[4-(6-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]-4-hexylbenzamide |
|---|---|
| PubChem CID | 42658273 |
| Molecular Formula | C26H26ClN3O |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-[4-(6-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]-4-hexylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)Nc2ccc(-c3cn4cc(Cl)ccc4n3)cc2)cc1 |
| InChI | InChI=1S/C26H26ClN3O/c1-2-3-4-5-6-19-7-9-21(10-8-19)26(31)28-23-14-11-20(12-15-23)24-18-30-17-22(27)13-16-25(30)29-24/h7-18H,2-6H2,1H3,(H,28,31) |
| InChIKey | LVDDRIZPDJLVJM-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|