C21H27NO — CID 142028227
4-butyl-N-(4-methylphenyl)benzamide;prop-1-ene (PubChem CID 142028227) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 4-butyl-N-(4-methylphenyl)benzamide;prop-1-ene.
| Compound Name | 4-butyl-N-(4-methylphenyl)benzamide;prop-1-ene |
|---|---|
| PubChem CID | 142028227 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 4-butyl-N-(4-methylphenyl)benzamide;prop-1-ene |
| SMILES | C=CC.CCCCc1ccc(C(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H21NO.C3H6/c1-3-4-5-15-8-10-16(11-9-15)18(20)19-17-12-6-14(2)7-13-17;1-3-2/h6-13H,3-5H2,1-2H3,(H,19,20);3H,1H2,2H3 |
| InChIKey | YIQWDGUHSYJHDD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|