C24H31NO — CID 72568774
N-(4-butylphenyl)-4-(4,4-dimethylpent-2-en-2-yl)benzamide (PubChem CID 72568774) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is N-(4-butylphenyl)-4-(4,4-dimethylpent-2-en-2-yl)benzamide.
| Compound Name | N-(4-butylphenyl)-4-(4,4-dimethylpent-2-en-2-yl)benzamide |
|---|---|
| PubChem CID | 72568774 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-(4-butylphenyl)-4-(4,4-dimethylpent-2-en-2-yl)benzamide |
| SMILES | CCCCc1ccc(NC(=O)c2ccc(C(C)=CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H31NO/c1-6-7-8-19-9-15-22(16-10-19)25-23(26)21-13-11-20(12-14-21)18(2)17-24(3,4)5/h9-17H,6-8H2,1-5H3,(H,25,26) |
| InChIKey | QYUQAVZWTMUHPJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |