C23H22Cl2N2O — CID 11304509
N-(2,4-dichlorophenyl)-4-(5-pentyl-2-pyridinyl)benzamide (PubChem CID 11304509) has the molecular formula C23H22Cl2N2O and a molecular weight of 413.35 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-(5-pentyl-2-pyridinyl)benzamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-(5-pentyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 11304509 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-(5-pentyl-2-pyridinyl)benzamide |
| SMILES | CCCCCc1ccc(-c2ccc(C(=O)Nc3ccc(Cl)cc3Cl)cc2)nc1 |
| InChI | InChI=1S/C23H22Cl2N2O/c1-2-3-4-5-16-6-12-21(26-15-16)17-7-9-18(10-8-17)23(28)27-22-13-11-19(24)14-20(22)25/h6-15H,2-5H2,1H3,(H,27,28) |
| InChIKey | XYVCHWVURUPXPV-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|