C34H48Br2N4O2 — CID 11297013
1-octyl-N-[4-[(1-octylpyridin-1-ium-4-carbonyl)amino]phenyl]pyridin-1-ium-4-carboxamide dibromide (PubChem CID 11297013) has the molecular formula C34H48Br2N4O2 and a molecular weight of 704.59 g/mol. Its IUPAC name is 1-octyl-N-[4-[(1-octylpyridin-1-ium-4-carbonyl)amino]phenyl]pyridin-1-ium-4-carboxamide dibromide.
| Compound Name | 1-octyl-N-[4-[(1-octylpyridin-1-ium-4-carbonyl)amino]phenyl]pyridin-1-ium-4-carboxamide dibromide |
|---|---|
| PubChem CID | 11297013 |
| Molecular Formula | C34H48Br2N4O2 |
| Molecular Weight | 704.59 g/mol |
| Exact Mass | 702.21 |
| IUPAC Name | 1-octyl-N-[4-[(1-octylpyridin-1-ium-4-carbonyl)amino]phenyl]pyridin-1-ium-4-carboxamide dibromide |
| SMILES | CCCCCCCC[n+]1ccc(C(=O)Nc2ccc(NC(=O)c3cc[n+](CCCCCCCC)cc3)cc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C34H46N4O2.2BrH/c1-3-5-7-9-11-13-23-37-25-19-29(20-26-37)33(39)35-31-15-17-32(18-16-31)36-34(40)30-21-27-38(28-22-30)24-14-12-10-8-6-4-2;;/h15-22,25-28H,3-14,23-24H2,1-2H3;2*1H |
| InChIKey | GNSRRDLPPKMERJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.59 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|