C40H46N6O4+2 — CID 3042653
1-N,4-N-bis[4-[(1-propylpyridin-1-ium-4-yl)carbamoyl]phenyl]bicyclo[2.2.2]octane-1,4-dicarboxamide (PubChem CID 3042653) has the molecular formula C40H46N6O4+2 and a molecular weight of 674.85 g/mol. Its IUPAC name is 1-N,4-N-bis[4-[(1-propylpyridin-1-ium-4-yl)carbamoyl]phenyl]bicyclo[2.2.2]octane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-[(1-propylpyridin-1-ium-4-yl)carbamoyl]phenyl]bicyclo[2.2.2]octane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 3042653 |
| Molecular Formula | C40H46N6O4+2 |
| Molecular Weight | 674.85 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | 1-N,4-N-bis[4-[(1-propylpyridin-1-ium-4-yl)carbamoyl]phenyl]bicyclo[2.2.2]octane-1,4-dicarboxamide |
| SMILES | CCC[n+]1ccc(NC(=O)c2ccc(NC(=O)C34CCC(C(=O)Nc5ccc(C(=O)Nc6cc[n+](CCC)cc6)cc5)(CC3)CC4)cc2)cc1 |
| InChI | InChI=1S/C40H44N6O4/c1-3-23-45-25-13-33(14-26-45)41-35(47)29-5-9-31(10-6-29)43-37(49)39-17-20-40(21-18-39,22-19-39)38(50)44-32-11-7-30(8-12-32)36(48)42-34-15-27-46(24-4-2)28-16-34/h5-16,25-28H,3-4,17-24H2,1-2H3,(H2,43,44,47,48,49,50)/p+2 |
| InChIKey | QYVNQEZEPJEDPP-UHFFFAOYSA-P |
| XLogP | 6.50 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.85 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|