C30H48N4O2+2 — CID 11467950
1-hexyl-N-[6-[(1-hexylpyridin-1-ium-4-carbonyl)amino]hexyl]pyridin-1-ium-4-carboxamide (PubChem CID 11467950) has the molecular formula C30H48N4O2+2 and a molecular weight of 496.74 g/mol. Its IUPAC name is 1-hexyl-N-[6-[(1-hexylpyridin-1-ium-4-carbonyl)amino]hexyl]pyridin-1-ium-4-carboxamide.
| Compound Name | 1-hexyl-N-[6-[(1-hexylpyridin-1-ium-4-carbonyl)amino]hexyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 11467950 |
| Molecular Formula | C30H48N4O2+2 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.38 |
| IUPAC Name | 1-hexyl-N-[6-[(1-hexylpyridin-1-ium-4-carbonyl)amino]hexyl]pyridin-1-ium-4-carboxamide |
| SMILES | CCCCCC[n+]1ccc(C(=O)NCCCCCCNC(=O)c2cc[n+](CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C30H46N4O2/c1-3-5-7-13-21-33-23-15-27(16-24-33)29(35)31-19-11-9-10-12-20-32-30(36)28-17-25-34(26-18-28)22-14-8-6-4-2/h15-18,23-26H,3-14,19-22H2,1-2H3/p+2 |
| InChIKey | AVRKVIRZKLJRAZ-UHFFFAOYSA-P |
| XLogP | 5.14 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|