C26H35N3O3 — CID 4958813
4-tert-butyl-N-[4-[(octanoylamino)carbamoyl]phenyl]benzamide (PubChem CID 4958813) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[(octanoylamino)carbamoyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[(octanoylamino)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4958813 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 4-tert-butyl-N-[4-[(octanoylamino)carbamoyl]phenyl]benzamide |
| SMILES | CCCCCCCC(=O)NNC(=O)c1ccc(NC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H35N3O3/c1-5-6-7-8-9-10-23(30)28-29-25(32)20-13-17-22(18-14-20)27-24(31)19-11-15-21(16-12-19)26(2,3)4/h11-18H,5-10H2,1-4H3,(H,27,31)(H,28,30)(H,29,32) |
| InChIKey | GVWIUVIPDWJJDW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|