C24H25Cl3N4O2 — CID 59816434
4-hexoxy-N-[4-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]benzamide (PubChem CID 59816434) has the molecular formula C24H25Cl3N4O2 and a molecular weight of 507.85 g/mol. Its IUPAC name is 4-hexoxy-N-[4-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]benzamide.
| Compound Name | 4-hexoxy-N-[4-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 59816434 |
| Molecular Formula | C24H25Cl3N4O2 |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 4-hexoxy-N-[4-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(-c3nc(C)nc(C(Cl)(Cl)Cl)n3)cc2)cc1 |
| InChI | InChI=1S/C24H25Cl3N4O2/c1-3-4-5-6-15-33-20-13-9-18(10-14-20)22(32)30-19-11-7-17(8-12-19)21-28-16(2)29-23(31-21)24(25,26)27/h7-14H,3-6,15H2,1-2H3,(H,30,32) |
| InChIKey | KVGLEPLXTFQWSI-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|