C20H15Cl9N6O2 — CID 91522070
N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]acetamide;2-[(E)-but-2-en-2-yl]-5-(trichloromethyl)-1,3,4-oxadiazole (PubChem CID 91522070) has the molecular formula C20H15Cl9N6O2 and a molecular weight of 690.46 g/mol. Its IUPAC name is N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]acetamide;2-[(E)-but-2-en-2-yl]-5-(trichloromethyl)-1,3,4-oxadiazole.
| Compound Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]acetamide;2-[(E)-but-2-en-2-yl]-5-(trichloromethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 91522070 |
| Molecular Formula | C20H15Cl9N6O2 |
| Molecular Weight | 690.46 g/mol |
| Exact Mass | 685.85 |
| IUPAC Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]acetamide;2-[(E)-but-2-en-2-yl]-5-(trichloromethyl)-1,3,4-oxadiazole |
| SMILES | C/C=C(\C)c1nnc(C(Cl)(Cl)Cl)o1.CC(=O)Nc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C13H8Cl6N4O.C7H7Cl3N2O/c1-6(24)20-8-4-2-7(3-5-8)9-21-10(12(14,15)16)23-11(22-9)13(17,18)19;1-3-4(2)5-11-12-6(13-5)7(8,9)10/h2-5H,1H3,(H,20,24);3H,1-2H3/b;4-3+ |
| InChIKey | GGQSOTUUIQGHOF-SCBDLNNBSA-N |
| XLogP | 8.47 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.46 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|