C18H29N2O8SSi- — CID 58871446
2-[4-(3-triethoxysilylpropylcarbamoylamino)phenyl]sulfonylacetate (PubChem CID 58871446) has the molecular formula C18H29N2O8SSi- and a molecular weight of 461.59 g/mol. Its IUPAC name is 2-[4-(3-triethoxysilylpropylcarbamoylamino)phenyl]sulfonylacetate.
| Compound Name | 2-[4-(3-triethoxysilylpropylcarbamoylamino)phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 58871446 |
| Molecular Formula | C18H29N2O8SSi- |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-[4-(3-triethoxysilylpropylcarbamoylamino)phenyl]sulfonylacetate |
| SMILES | CCO[Si](CCCNC(=O)Nc1ccc(S(=O)(=O)CC(=O)[O-])cc1)(OCC)OCC |
| InChI | InChI=1S/C18H30N2O8SSi/c1-4-26-30(27-5-2,28-6-3)13-7-12-19-18(23)20-15-8-10-16(11-9-15)29(24,25)14-17(21)22/h8-11H,4-7,12-14H2,1-3H3,(H,21,22)(H2,19,20,23)/p-1 |
| InChIKey | AKEZQEISOIUHON-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 143.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|