C18H30N4O5S — CID 163717383
4-[8-(ethylcarbamoylamino)octylcarbamoylamino]benzenesulfonic acid (PubChem CID 163717383) has the molecular formula C18H30N4O5S and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-[8-(ethylcarbamoylamino)octylcarbamoylamino]benzenesulfonic acid.
| Compound Name | 4-[8-(ethylcarbamoylamino)octylcarbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 163717383 |
| Molecular Formula | C18H30N4O5S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 4-[8-(ethylcarbamoylamino)octylcarbamoylamino]benzenesulfonic acid |
| SMILES | CCNC(=O)NCCCCCCCCNC(=O)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H30N4O5S/c1-2-19-17(23)20-13-7-5-3-4-6-8-14-21-18(24)22-15-9-11-16(12-10-15)28(25,26)27/h9-12H,2-8,13-14H2,1H3,(H2,19,20,23)(H2,21,22,24)(H,25,26,27) |
| InChIKey | KOOCHGNZBXVPSQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|