C13H17N3O5S — CID 90311544
2-methylidene-5-[(4-sulfamoylphenyl)carbamoylamino]pentanoic acid (PubChem CID 90311544) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-methylidene-5-[(4-sulfamoylphenyl)carbamoylamino]pentanoic acid.
| Compound Name | 2-methylidene-5-[(4-sulfamoylphenyl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 90311544 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-methylidene-5-[(4-sulfamoylphenyl)carbamoylamino]pentanoic acid |
| SMILES | C=C(CCCNC(=O)Nc1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H17N3O5S/c1-9(12(17)18)3-2-8-15-13(19)16-10-4-6-11(7-5-10)22(14,20)21/h4-7H,1-3,8H2,(H,17,18)(H2,14,20,21)(H2,15,16,19) |
| InChIKey | VYQVMYKMSFTKMT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|