C14H20N6O4S — CID 21281464
7-[(4-sulfamoylphenyl)carbamoylamino]heptanoyl azide (PubChem CID 21281464) has the molecular formula C14H20N6O4S and a molecular weight of 368.42 g/mol. Its IUPAC name is 7-[(4-sulfamoylphenyl)carbamoylamino]heptanoyl azide.
| Compound Name | 7-[(4-sulfamoylphenyl)carbamoylamino]heptanoyl azide |
|---|---|
| PubChem CID | 21281464 |
| Molecular Formula | C14H20N6O4S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 7-[(4-sulfamoylphenyl)carbamoylamino]heptanoyl azide |
| SMILES | [N-]=[N+]=NC(=O)CCCCCCNC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H20N6O4S/c15-20-19-13(21)5-3-1-2-4-10-17-14(22)18-11-6-8-12(9-7-11)25(16,23)24/h6-9H,1-5,10H2,(H2,16,23,24)(H2,17,18,22) |
| InChIKey | RVIJOMYXLFYZOB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 167.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|