C21H28ClN5O3S — CID 160562971
1-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propyl]-3-(4-sulfamoylphenyl)urea (PubChem CID 160562971) has the molecular formula C21H28ClN5O3S and a molecular weight of 466.01 g/mol. Its IUPAC name is 1-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propyl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propyl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 160562971 |
| Molecular Formula | C21H28ClN5O3S |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 1-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propyl]-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)NCCCN2CCN(Cc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H28ClN5O3S/c22-18-4-2-17(3-5-18)16-27-14-12-26(13-15-27)11-1-10-24-21(28)25-19-6-8-20(9-7-19)31(23,29)30/h2-9H,1,10-16H2,(H2,23,29,30)(H2,24,25,28) |
| InChIKey | QZOFMAHTTSSFNZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|